C12H21N3O — CID 115156483
4-amino-N,3-dimethyl-N-[2-(1H-pyrrol-2-yl)ethyl]butanamide (PubChem CID 115156483) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is 4-amino-N,3-dimethyl-N-[2-(1H-pyrrol-2-yl)ethyl]butanamide.
| Compound Name | 4-amino-N,3-dimethyl-N-[2-(1H-pyrrol-2-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 115156483 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 4-amino-N,3-dimethyl-N-[2-(1H-pyrrol-2-yl)ethyl]butanamide |
| SMILES | CC(CN)CC(=O)N(C)CCc1ccc[nH]1 |
| InChI | InChI=1S/C12H21N3O/c1-10(9-13)8-12(16)15(2)7-5-11-4-3-6-14-11/h3-4,6,10,14H,5,7-9,13H2,1-2H3 |
| InChIKey | DIUREGUCGAYGFC-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |