C14H22N2O2 — CID 115165646
N-(4-ethoxyphenyl)-N,2-dimethyl-2-(methylamino)propanamide (PubChem CID 115165646) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-N,2-dimethyl-2-(methylamino)propanamide.
| Compound Name | N-(4-ethoxyphenyl)-N,2-dimethyl-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 115165646 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | N-(4-ethoxyphenyl)-N,2-dimethyl-2-(methylamino)propanamide |
| SMILES | CCOc1ccc(N(C)C(=O)C(C)(C)NC)cc1 |
| InChI | InChI=1S/C14H22N2O2/c1-6-18-12-9-7-11(8-10-12)16(5)13(17)14(2,3)15-4/h7-10,15H,6H2,1-5H3 |
| InChIKey | YNVJKGGSVCSSMF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |