C13H18BrNOS — CID 115168128
N-[2-(4-bromophenyl)-2-methylpropyl]-3-sulfanylpropanamide (PubChem CID 115168128) has the molecular formula C13H18BrNOS and a molecular weight of 316.26 g/mol. Its IUPAC name is N-[2-(4-bromophenyl)-2-methylpropyl]-3-sulfanylpropanamide.
| Compound Name | N-[2-(4-bromophenyl)-2-methylpropyl]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 115168128 |
| Molecular Formula | C13H18BrNOS |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | N-[2-(4-bromophenyl)-2-methylpropyl]-3-sulfanylpropanamide |
| SMILES | CC(C)(CNC(=O)CCS)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H18BrNOS/c1-13(2,9-15-12(16)7-8-17)10-3-5-11(14)6-4-10/h3-6,17H,7-9H2,1-2H3,(H,15,16) |
| InChIKey | KMJSANWISZFNKX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|