C8H13N3O — CID 115169243
1,3-dimethyl-1-(1H-pyrrol-3-ylmethyl)urea (PubChem CID 115169243) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is 1,3-dimethyl-1-(1H-pyrrol-3-ylmethyl)urea.
| Compound Name | 1,3-dimethyl-1-(1H-pyrrol-3-ylmethyl)urea |
|---|---|
| PubChem CID | 115169243 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 1,3-dimethyl-1-(1H-pyrrol-3-ylmethyl)urea |
| SMILES | CNC(=O)N(C)Cc1cc[nH]c1 |
| InChI | InChI=1S/C8H13N3O/c1-9-8(12)11(2)6-7-3-4-10-5-7/h3-5,10H,6H2,1-2H3,(H,9,12) |
| InChIKey | APXMYHMBLQVQFT-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |