C10H20N2O — CID 115169542
1-(2-cyclopentylethyl)-1,3-dimethylurea (PubChem CID 115169542) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is 1-(2-cyclopentylethyl)-1,3-dimethylurea.
| Compound Name | 1-(2-cyclopentylethyl)-1,3-dimethylurea |
|---|---|
| PubChem CID | 115169542 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 1-(2-cyclopentylethyl)-1,3-dimethylurea |
| SMILES | CNC(=O)N(C)CCC1CCCC1 |
| InChI | InChI=1S/C10H20N2O/c1-11-10(13)12(2)8-7-9-5-3-4-6-9/h9H,3-8H2,1-2H3,(H,11,13) |
| InChIKey | VLGKNGAJTISLOI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |