C17H32N2S — CID 18716766
1,3-bis(2-cyclopentylethyl)-1,3-dimethylthiourea (PubChem CID 18716766) has the molecular formula C17H32N2S and a molecular weight of 296.52 g/mol. Its IUPAC name is 1,3-bis(2-cyclopentylethyl)-1,3-dimethylthiourea.
| Compound Name | 1,3-bis(2-cyclopentylethyl)-1,3-dimethylthiourea |
|---|---|
| PubChem CID | 18716766 |
| Molecular Formula | C17H32N2S |
| Molecular Weight | 296.52 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | 1,3-bis(2-cyclopentylethyl)-1,3-dimethylthiourea |
| SMILES | CN(CCC1CCCC1)C(=S)N(C)CCC1CCCC1 |
| InChI | InChI=1S/C17H32N2S/c1-18(13-11-15-7-3-4-8-15)17(20)19(2)14-12-16-9-5-6-10-16/h15-16H,3-14H2,1-2H3 |
| InChIKey | MBWIRUJRTGRHHW-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|