C12H15NOS — CID 115170087
2,3-dihydro-1H-inden-5-ylmethyl(methyl)carbamothioic S-acid (PubChem CID 115170087) has the molecular formula C12H15NOS and a molecular weight of 221.32 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-5-ylmethyl(methyl)carbamothioic S-acid.
| Compound Name | 2,3-dihydro-1H-inden-5-ylmethyl(methyl)carbamothioic S-acid |
|---|---|
| PubChem CID | 115170087 |
| Molecular Formula | C12H15NOS |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 2,3-dihydro-1H-inden-5-ylmethyl(methyl)carbamothioic S-acid |
| SMILES | CN(Cc1ccc2c(c1)CCC2)C(=O)S |
| InChI | InChI=1S/C12H15NOS/c1-13(12(14)15)8-9-5-6-10-3-2-4-11(10)7-9/h5-7H,2-4,8H2,1H3,(H,14,15) |
| InChIKey | NPQDLBQDVRPYSW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|