C13H19NS — CID 115228031
[methyl(5,6,7,8-tetrahydronaphthalen-2-ylmethyl)amino]methanethiol (PubChem CID 115228031) has the molecular formula C13H19NS and a molecular weight of 221.37 g/mol. Its IUPAC name is [methyl(5,6,7,8-tetrahydronaphthalen-2-ylmethyl)amino]methanethiol.
| Compound Name | [methyl(5,6,7,8-tetrahydronaphthalen-2-ylmethyl)amino]methanethiol |
|---|---|
| PubChem CID | 115228031 |
| Molecular Formula | C13H19NS |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | [methyl(5,6,7,8-tetrahydronaphthalen-2-ylmethyl)amino]methanethiol |
| SMILES | CN(CS)Cc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C13H19NS/c1-14(10-15)9-11-6-7-12-4-2-3-5-13(12)8-11/h6-8,15H,2-5,9-10H2,1H3 |
| InChIKey | BQAMYVAUACOFMI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|