C22H33N — CID 176731758
3-cyclohexyl-N-methyl-N-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-ylmethyl)prop-2-en-1-amine (PubChem CID 176731758) has the molecular formula C22H33N and a molecular weight of 311.51 g/mol. Its IUPAC name is 3-cyclohexyl-N-methyl-N-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-ylmethyl)prop-2-en-1-amine.
| Compound Name | 3-cyclohexyl-N-methyl-N-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-ylmethyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 176731758 |
| Molecular Formula | C22H33N |
| Molecular Weight | 311.51 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | 3-cyclohexyl-N-methyl-N-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-ylmethyl)prop-2-en-1-amine |
| SMILES | CN(CC=CC1CCCCC1)Cc1ccc2c(c1)CCCCC2 |
| InChI | InChI=1S/C22H33N/c1-23(16-8-11-19-9-4-2-5-10-19)18-20-14-15-21-12-6-3-7-13-22(21)17-20/h8,11,14-15,17,19H,2-7,9-10,12-13,16,18H2,1H3 |
| InChIKey | QMUGPXBAVNMVEV-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.51 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|