C19H27NO — CID 176731872
3-cyclohexyl-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-N-methylprop-2-en-1-amine (PubChem CID 176731872) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is 3-cyclohexyl-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-N-methylprop-2-en-1-amine.
| Compound Name | 3-cyclohexyl-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-N-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 176731872 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | 3-cyclohexyl-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-N-methylprop-2-en-1-amine |
| SMILES | CN(CC=CC1CCCCC1)Cc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C19H27NO/c1-20(12-5-8-16-6-3-2-4-7-16)15-17-9-10-19-18(14-17)11-13-21-19/h5,8-10,14,16H,2-4,6-7,11-13,15H2,1H3 |
| InChIKey | XVEBCLHLFNHHOY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|