C17H24ClN — CID 102637515
2-chloro-N-(2,3-dihydro-1H-inden-5-ylmethyl)-N-methylcyclohexan-1-amine (PubChem CID 102637515) has the molecular formula C17H24ClN and a molecular weight of 277.84 g/mol. Its IUPAC name is 2-chloro-N-(2,3-dihydro-1H-inden-5-ylmethyl)-N-methylcyclohexan-1-amine.
| Compound Name | 2-chloro-N-(2,3-dihydro-1H-inden-5-ylmethyl)-N-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 102637515 |
| Molecular Formula | C17H24ClN |
| Molecular Weight | 277.84 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 2-chloro-N-(2,3-dihydro-1H-inden-5-ylmethyl)-N-methylcyclohexan-1-amine |
| SMILES | CN(Cc1ccc2c(c1)CCC2)C1CCCCC1Cl |
| InChI | InChI=1S/C17H24ClN/c1-19(17-8-3-2-7-16(17)18)12-13-9-10-14-5-4-6-15(14)11-13/h9-11,16-17H,2-8,12H2,1H3 |
| InChIKey | YMIQDBJUHWHZHG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.84 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|