C15H21ClFN — CID 102637410
2-chloro-N-[(4-fluoro-2-methylphenyl)methyl]-N-methylcyclohexan-1-amine (PubChem CID 102637410) has the molecular formula C15H21ClFN and a molecular weight of 269.79 g/mol. Its IUPAC name is 2-chloro-N-[(4-fluoro-2-methylphenyl)methyl]-N-methylcyclohexan-1-amine.
| Compound Name | 2-chloro-N-[(4-fluoro-2-methylphenyl)methyl]-N-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 102637410 |
| Molecular Formula | C15H21ClFN |
| Molecular Weight | 269.79 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 2-chloro-N-[(4-fluoro-2-methylphenyl)methyl]-N-methylcyclohexan-1-amine |
| SMILES | Cc1cc(F)ccc1CN(C)C1CCCCC1Cl |
| InChI | InChI=1S/C15H21ClFN/c1-11-9-13(17)8-7-12(11)10-18(2)15-6-4-3-5-14(15)16/h7-9,14-15H,3-6,10H2,1-2H3 |
| InChIKey | PPWQWLFEXIXDJB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.79 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|