C15H20ClF — CID 114348646
1-chloro-2-[(4-fluoro-2-methylphenyl)methyl]cycloheptane (PubChem CID 114348646) has the molecular formula C15H20ClF and a molecular weight of 254.78 g/mol. Its IUPAC name is 1-chloro-2-[(4-fluoro-2-methylphenyl)methyl]cycloheptane.
| Compound Name | 1-chloro-2-[(4-fluoro-2-methylphenyl)methyl]cycloheptane |
|---|---|
| PubChem CID | 114348646 |
| Molecular Formula | C15H20ClF |
| Molecular Weight | 254.78 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 1-chloro-2-[(4-fluoro-2-methylphenyl)methyl]cycloheptane |
| SMILES | Cc1cc(F)ccc1CC1CCCCCC1Cl |
| InChI | InChI=1S/C15H20ClF/c1-11-9-14(17)8-7-12(11)10-13-5-3-2-4-6-15(13)16/h7-9,13,15H,2-6,10H2,1H3 |
| InChIKey | WDWOMRBAORBDPL-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.78 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|