C14H17ClF2 — CID 55219699
1-chloro-2-[(2,5-difluorophenyl)methyl]cycloheptane (PubChem CID 55219699) has the molecular formula C14H17ClF2 and a molecular weight of 258.74 g/mol. Its IUPAC name is 1-chloro-2-[(2,5-difluorophenyl)methyl]cycloheptane.
| Compound Name | 1-chloro-2-[(2,5-difluorophenyl)methyl]cycloheptane |
|---|---|
| PubChem CID | 55219699 |
| Molecular Formula | C14H17ClF2 |
| Molecular Weight | 258.74 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 1-chloro-2-[(2,5-difluorophenyl)methyl]cycloheptane |
| SMILES | Fc1ccc(F)c(CC2CCCCCC2Cl)c1 |
| InChI | InChI=1S/C14H17ClF2/c15-13-5-3-1-2-4-10(13)8-11-9-12(16)6-7-14(11)17/h6-7,9-10,13H,1-5,8H2 |
| InChIKey | UEZCNVUPRHENSH-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.74 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|