C12H17NOS2 — CID 115170158
methyl-[(4-propan-2-ylsulfanylphenyl)methyl]carbamothioic S-acid (PubChem CID 115170158) has the molecular formula C12H17NOS2 and a molecular weight of 255.41 g/mol. Its IUPAC name is methyl-[(4-propan-2-ylsulfanylphenyl)methyl]carbamothioic S-acid.
| Compound Name | methyl-[(4-propan-2-ylsulfanylphenyl)methyl]carbamothioic S-acid |
|---|---|
| PubChem CID | 115170158 |
| Molecular Formula | C12H17NOS2 |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | methyl-[(4-propan-2-ylsulfanylphenyl)methyl]carbamothioic S-acid |
| SMILES | CC(C)Sc1ccc(CN(C)C(=O)S)cc1 |
| InChI | InChI=1S/C12H17NOS2/c1-9(2)16-11-6-4-10(5-7-11)8-13(3)12(14)15/h4-7,9H,8H2,1-3H3,(H,14,15) |
| InChIKey | UBHOSXBYMNQSTE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|