C14H21NOS — CID 115170312
2-(4-tert-butyl-2-methylphenyl)ethylcarbamothioic S-acid (PubChem CID 115170312) has the molecular formula C14H21NOS and a molecular weight of 251.39 g/mol. Its IUPAC name is 2-(4-tert-butyl-2-methylphenyl)ethylcarbamothioic S-acid.
| Compound Name | 2-(4-tert-butyl-2-methylphenyl)ethylcarbamothioic S-acid |
|---|---|
| PubChem CID | 115170312 |
| Molecular Formula | C14H21NOS |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 2-(4-tert-butyl-2-methylphenyl)ethylcarbamothioic S-acid |
| SMILES | Cc1cc(C(C)(C)C)ccc1CCNC(=O)S |
| InChI | InChI=1S/C14H21NOS/c1-10-9-12(14(2,3)4)6-5-11(10)7-8-15-13(16)17/h5-6,9H,7-8H2,1-4H3,(H2,15,16,17) |
| InChIKey | IXTMQSOZTKYVCB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|