C15H20N2O — CID 115172539
N-[2-(4-tert-butyl-2-methylphenyl)ethyl]-1-cyanoformamide (PubChem CID 115172539) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is N-[2-(4-tert-butyl-2-methylphenyl)ethyl]-1-cyanoformamide.
| Compound Name | N-[2-(4-tert-butyl-2-methylphenyl)ethyl]-1-cyanoformamide |
|---|---|
| PubChem CID | 115172539 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | N-[2-(4-tert-butyl-2-methylphenyl)ethyl]-1-cyanoformamide |
| SMILES | Cc1cc(C(C)(C)C)ccc1CCNC(=O)C#N |
| InChI | InChI=1S/C15H20N2O/c1-11-9-13(15(2,3)4)6-5-12(11)7-8-17-14(18)10-16/h5-6,9H,7-8H2,1-4H3,(H,17,18) |
| InChIKey | LOKUTZHFJUYNOE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|