C10H12N2OS — CID 115173840
3-cyano-N-[(3-methylthiophen-2-yl)methyl]propanamide (PubChem CID 115173840) has the molecular formula C10H12N2OS and a molecular weight of 208.29 g/mol. Its IUPAC name is 3-cyano-N-[(3-methylthiophen-2-yl)methyl]propanamide.
| Compound Name | 3-cyano-N-[(3-methylthiophen-2-yl)methyl]propanamide |
|---|---|
| PubChem CID | 115173840 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 3-cyano-N-[(3-methylthiophen-2-yl)methyl]propanamide |
| SMILES | Cc1ccsc1CNC(=O)CCC#N |
| InChI | InChI=1S/C10H12N2OS/c1-8-4-6-14-9(8)7-12-10(13)3-2-5-11/h4,6H,2-3,7H2,1H3,(H,12,13) |
| InChIKey | XGFWKDJPOMZZIK-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |