C16H19NO3S — CID 134056529
3-(2-methoxyphenoxy)-N-[(3-methylthiophen-2-yl)methyl]propanamide (PubChem CID 134056529) has the molecular formula C16H19NO3S and a molecular weight of 305.40 g/mol. Its IUPAC name is 3-(2-methoxyphenoxy)-N-[(3-methylthiophen-2-yl)methyl]propanamide.
| Compound Name | 3-(2-methoxyphenoxy)-N-[(3-methylthiophen-2-yl)methyl]propanamide |
|---|---|
| PubChem CID | 134056529 |
| Molecular Formula | C16H19NO3S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 3-(2-methoxyphenoxy)-N-[(3-methylthiophen-2-yl)methyl]propanamide |
| SMILES | COc1ccccc1OCCC(=O)NCc1sccc1C |
| InChI | InChI=1S/C16H19NO3S/c1-12-8-10-21-15(12)11-17-16(18)7-9-20-14-6-4-3-5-13(14)19-2/h3-6,8,10H,7,9,11H2,1-2H3,(H,17,18) |
| InChIKey | GVGODLBPNTVMOA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |