C12H15NO4S — CID 115175667
N-[(4-ethylsulfonylphenyl)methyl]-2-oxopropanamide (PubChem CID 115175667) has the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. Its IUPAC name is N-[(4-ethylsulfonylphenyl)methyl]-2-oxopropanamide.
| Compound Name | N-[(4-ethylsulfonylphenyl)methyl]-2-oxopropanamide |
|---|---|
| PubChem CID | 115175667 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | N-[(4-ethylsulfonylphenyl)methyl]-2-oxopropanamide |
| SMILES | CCS(=O)(=O)c1ccc(CNC(=O)C(C)=O)cc1 |
| InChI | InChI=1S/C12H15NO4S/c1-3-18(16,17)11-6-4-10(5-7-11)8-13-12(15)9(2)14/h4-7H,3,8H2,1-2H3,(H,13,15) |
| InChIKey | PDDWLGNVULWHBZ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|