C26H28N2O3S — CID 135136426
N-[(4-ethylsulfonylphenyl)methyl]-3,4-diphenylpyrrolidine-1-carboxamide (PubChem CID 135136426) has the molecular formula C26H28N2O3S and a molecular weight of 448.59 g/mol. Its IUPAC name is N-[(4-ethylsulfonylphenyl)methyl]-3,4-diphenylpyrrolidine-1-carboxamide.
| Compound Name | N-[(4-ethylsulfonylphenyl)methyl]-3,4-diphenylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 135136426 |
| Molecular Formula | C26H28N2O3S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | N-[(4-ethylsulfonylphenyl)methyl]-3,4-diphenylpyrrolidine-1-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc(CNC(=O)N2CC(c3ccccc3)C(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C26H28N2O3S/c1-2-32(30,31)23-15-13-20(14-16-23)17-27-26(29)28-18-24(21-9-5-3-6-10-21)25(19-28)22-11-7-4-8-12-22/h3-16,24-25H,2,17-19H2,1H3,(H,27,29) |
| InChIKey | XACDGDCXLPSAGK-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |