C30H30F6N2O4S — CID 153313938
(3R,4R)-N-[(4-ethylsulfonylphenyl)methyl]-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidine-1-carboxamide (PubChem CID 153313938) has the molecular formula C30H30F6N2O4S and a molecular weight of 628.64 g/mol. Its IUPAC name is (3R,4R)-N-[(4-ethylsulfonylphenyl)methyl]-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidine-1-carboxamide.
| Compound Name | (3R,4R)-N-[(4-ethylsulfonylphenyl)methyl]-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 153313938 |
| Molecular Formula | C30H30F6N2O4S |
| Molecular Weight | 628.64 g/mol |
| Exact Mass | 628.18 |
| IUPAC Name | (3R,4R)-N-[(4-ethylsulfonylphenyl)methyl]-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidine-1-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc(CNC(=O)N2C[C@H](c3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)[C@](C)(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C30H30F6N2O4S/c1-3-43(41,42)24-15-9-20(10-16-24)17-37-26(39)38-18-25(27(2,19-38)22-7-5-4-6-8-22)21-11-13-23(14-12-21)28(40,29(31,32)33)30(34,35)36/h4-16,25,40H,3,17-19H2,1-2H3,(H,37,39)/t25-,27+/m1/s1 |
| InChIKey | IQPMCGWRMVHGLH-VPUSJEBWSA-N |
| XLogP | 6.06 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.64 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |