C21H21F6NO3S — CID 153313944
1,1,1,3,3,3-hexafluoro-2-[4-[(3S,4S)-4-methyl-1-methylsulfonyl-4-phenylpyrrolidin-3-yl]phenyl]propan-2-ol (PubChem CID 153313944) has the molecular formula C21H21F6NO3S and a molecular weight of 481.46 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[4-[(3S,4S)-4-methyl-1-methylsulfonyl-4-phenylpyrrolidin-3-yl]phenyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[4-[(3S,4S)-4-methyl-1-methylsulfonyl-4-phenylpyrrolidin-3-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 153313944 |
| Molecular Formula | C21H21F6NO3S |
| Molecular Weight | 481.46 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[4-[(3S,4S)-4-methyl-1-methylsulfonyl-4-phenylpyrrolidin-3-yl]phenyl]propan-2-ol |
| SMILES | C[C@]1(c2ccccc2)CN(S(C)(=O)=O)C[C@H]1c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H21F6NO3S/c1-18(15-6-4-3-5-7-15)13-28(32(2,30)31)12-17(18)14-8-10-16(11-9-14)19(29,20(22,23)24)21(25,26)27/h3-11,17,29H,12-13H2,1-2H3/t17-,18+/m0/s1 |
| InChIKey | QEFHNUQIMHPUHY-ZWKOTPCHSA-N |
| XLogP | 4.32 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.46 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |