C27H28F7N3O3 — CID 153313913
4-[(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylpyrrolidine-1-carbonyl]piperidine-1-carboxamide (PubChem CID 153313913) has the molecular formula C27H28F7N3O3 and a molecular weight of 575.53 g/mol. Its IUPAC name is 4-[(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylpyrrolidine-1-carbonyl]piperidine-1-carboxamide.
| Compound Name | 4-[(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylpyrrolidine-1-carbonyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 153313913 |
| Molecular Formula | C27H28F7N3O3 |
| Molecular Weight | 575.53 g/mol |
| Exact Mass | 575.20 |
| IUPAC Name | 4-[(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylpyrrolidine-1-carbonyl]piperidine-1-carboxamide |
| SMILES | C[C@]1(c2ccc(F)cc2)CN(C(=O)C2CCN(C(N)=O)CC2)C[C@H]1c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H28F7N3O3/c1-24(18-6-8-20(28)9-7-18)15-37(22(38)17-10-12-36(13-11-17)23(35)39)14-21(24)16-2-4-19(5-3-16)25(40,26(29,30)31)27(32,33)34/h2-9,17,21,40H,10-15H2,1H3,(H2,35,39)/t21-,24+/m0/s1 |
| InChIKey | UQQGWBXOULNAGK-XUZZJYLKSA-N |
| XLogP | 4.81 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.53 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |