C31H28F8N2O — CID 162056849
[(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-methylpyrrolidin-1-yl]-(3-phenylpyrrolidin-1-yl)methanone (PubChem CID 162056849) has the molecular formula C31H28F8N2O and a molecular weight of 596.56 g/mol. Its IUPAC name is [(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-methylpyrrolidin-1-yl]-(3-phenylpyrrolidin-1-yl)methanone.
| Compound Name | [(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-methylpyrrolidin-1-yl]-(3-phenylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 162056849 |
| Molecular Formula | C31H28F8N2O |
| Molecular Weight | 596.56 g/mol |
| Exact Mass | 596.21 |
| IUPAC Name | [(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-methylpyrrolidin-1-yl]-(3-phenylpyrrolidin-1-yl)methanone |
| SMILES | C[C@]1(c2ccc(F)cc2)CN(C(=O)N2CCC(c3ccccc3)C2)C[C@H]1c1ccc(C(F)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C31H28F8N2O/c1-28(23-11-13-25(32)14-12-23)19-41(27(42)40-16-15-22(17-40)20-5-3-2-4-6-20)18-26(28)21-7-9-24(10-8-21)29(33,30(34,35)36)31(37,38)39/h2-14,22,26H,15-19H2,1H3/t22?,26-,28+/m0/s1 |
| InChIKey | RMZGHHGSWNMTPO-SDKBWILHSA-N |
| XLogP | 8.08 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.56 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |