C23H23F6NO3 — CID 153313952
1-[(3S,4S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidin-1-yl]-2-methoxyethanone (PubChem CID 153313952) has the molecular formula C23H23F6NO3 and a molecular weight of 475.43 g/mol. Its IUPAC name is 1-[(3S,4S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidin-1-yl]-2-methoxyethanone.
| Compound Name | 1-[(3S,4S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidin-1-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 153313952 |
| Molecular Formula | C23H23F6NO3 |
| Molecular Weight | 475.43 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | 1-[(3S,4S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidin-1-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1C[C@@H](c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)[C@@](C)(c2ccccc2)C1 |
| InChI | InChI=1S/C23H23F6NO3/c1-20(16-6-4-3-5-7-16)14-30(19(31)13-33-2)12-18(20)15-8-10-17(11-9-15)21(32,22(24,25)26)23(27,28)29/h3-11,18,32H,12-14H2,1-2H3/t18-,20+/m0/s1 |
| InChIKey | UVZSTIGBGVUEKX-AZUAARDMSA-N |
| XLogP | 4.53 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.43 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |