C29H32F6N2O2 — CID 134506981
1-[4-[(3R,4R)-3-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)phenyl]-3-methyl-4-phenylpyrrolidine-1-carbonyl]piperidin-1-yl]ethanone (PubChem CID 134506981) has the molecular formula C29H32F6N2O2 and a molecular weight of 554.58 g/mol. Its IUPAC name is 1-[4-[(3R,4R)-3-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)phenyl]-3-methyl-4-phenylpyrrolidine-1-carbonyl]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[(3R,4R)-3-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)phenyl]-3-methyl-4-phenylpyrrolidine-1-carbonyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 134506981 |
| Molecular Formula | C29H32F6N2O2 |
| Molecular Weight | 554.58 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | 1-[4-[(3R,4R)-3-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)phenyl]-3-methyl-4-phenylpyrrolidine-1-carbonyl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(C(=O)N2C[C@H](c3ccccc3)[C@](C)(c3ccc(C(C)(C(F)(F)F)C(F)(F)F)cc3)C2)CC1 |
| InChI | InChI=1S/C29H32F6N2O2/c1-19(38)36-15-13-21(14-16-36)25(39)37-17-24(20-7-5-4-6-8-20)26(2,18-37)22-9-11-23(12-10-22)27(3,28(30,31)32)29(33,34)35/h4-12,21,24H,13-18H2,1-3H3/t24-,26+/m1/s1 |
| InChIKey | VQJDEMCOOUADCH-RSXGOPAZSA-N |
| XLogP | 6.21 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.58 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |