C30H28F7N3O2 — CID 153313930
[(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylpyrrolidin-1-yl]-(3-pyridin-3-ylpyrrolidin-1-yl)methanone (PubChem CID 153313930) has the molecular formula C30H28F7N3O2 and a molecular weight of 595.56 g/mol. Its IUPAC name is [(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylpyrrolidin-1-yl]-(3-pyridin-3-ylpyrrolidin-1-yl)methanone.
| Compound Name | [(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylpyrrolidin-1-yl]-(3-pyridin-3-ylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 153313930 |
| Molecular Formula | C30H28F7N3O2 |
| Molecular Weight | 595.56 g/mol |
| Exact Mass | 595.21 |
| IUPAC Name | [(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylpyrrolidin-1-yl]-(3-pyridin-3-ylpyrrolidin-1-yl)methanone |
| SMILES | C[C@]1(c2ccc(F)cc2)CN(C(=O)N2CCC(c3cccnc3)C2)C[C@H]1c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C30H28F7N3O2/c1-27(22-8-10-24(31)11-9-22)18-40(26(41)39-14-12-21(16-39)20-3-2-13-38-15-20)17-25(27)19-4-6-23(7-5-19)28(42,29(32,33)34)30(35,36)37/h2-11,13,15,21,25,42H,12,14,16-18H2,1H3/t21?,25-,27+/m0/s1 |
| InChIKey | DJFATLMUXZPOLD-DCRAVRKTSA-N |
| XLogP | 6.50 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.56 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |