C30H28F7NO4S — CID 149393644
2-(4-ethylsulfonylphenyl)-1-[(3R,4R)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylpyrrolidin-1-yl]ethanone (PubChem CID 149393644) has the molecular formula C30H28F7NO4S and a molecular weight of 631.61 g/mol. Its IUPAC name is 2-(4-ethylsulfonylphenyl)-1-[(3R,4R)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylpyrrolidin-1-yl]ethanone.
| Compound Name | 2-(4-ethylsulfonylphenyl)-1-[(3R,4R)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylpyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 149393644 |
| Molecular Formula | C30H28F7NO4S |
| Molecular Weight | 631.61 g/mol |
| Exact Mass | 631.16 |
| IUPAC Name | 2-(4-ethylsulfonylphenyl)-1-[(3R,4R)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylpyrrolidin-1-yl]ethanone |
| SMILES | CCS(=O)(=O)c1ccc(CC(=O)N2C[C@H](c3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)[C@](C)(c3ccc(F)cc3)C2)cc1 |
| InChI | InChI=1S/C30H28F7NO4S/c1-3-43(41,42)24-14-4-19(5-15-24)16-26(39)38-17-25(27(2,18-38)21-10-12-23(31)13-11-21)20-6-8-22(9-7-20)28(40,29(32,33)34)30(35,36)37/h4-15,25,40H,3,16-18H2,1-2H3/t25-,27+/m1/s1 |
| InChIKey | YOADQVOANAJWIH-VPUSJEBWSA-N |
| XLogP | 6.06 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.61 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |