C14H18FNO3 — CID 115176113
N-[2-(5-fluoro-2-methoxyphenyl)-2-methylpropyl]-2-oxopropanamide (PubChem CID 115176113) has the molecular formula C14H18FNO3 and a molecular weight of 267.30 g/mol. Its IUPAC name is N-[2-(5-fluoro-2-methoxyphenyl)-2-methylpropyl]-2-oxopropanamide.
| Compound Name | N-[2-(5-fluoro-2-methoxyphenyl)-2-methylpropyl]-2-oxopropanamide |
|---|---|
| PubChem CID | 115176113 |
| Molecular Formula | C14H18FNO3 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | N-[2-(5-fluoro-2-methoxyphenyl)-2-methylpropyl]-2-oxopropanamide |
| SMILES | COc1ccc(F)cc1C(C)(C)CNC(=O)C(C)=O |
| InChI | InChI=1S/C14H18FNO3/c1-9(17)13(18)16-8-14(2,3)11-7-10(15)5-6-12(11)19-4/h5-7H,8H2,1-4H3,(H,16,18) |
| InChIKey | IEGYWRIVRVPEOY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|