C15H21NO2 — CID 115176780
N-methyl-4-oxo-N-(2,4,6-trimethylphenyl)pentanamide (PubChem CID 115176780) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is N-methyl-4-oxo-N-(2,4,6-trimethylphenyl)pentanamide.
| Compound Name | N-methyl-4-oxo-N-(2,4,6-trimethylphenyl)pentanamide |
|---|---|
| PubChem CID | 115176780 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | N-methyl-4-oxo-N-(2,4,6-trimethylphenyl)pentanamide |
| SMILES | CC(=O)CCC(=O)N(C)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C15H21NO2/c1-10-8-11(2)15(12(3)9-10)16(5)14(18)7-6-13(4)17/h8-9H,6-7H2,1-5H3 |
| InChIKey | FLPNMZXUCMJOON-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |