C13H17F2N3O — CID 115178001
N-[(2,4-difluorophenyl)methyl]-4-methylpiperazine-2-carboxamide (PubChem CID 115178001) has the molecular formula C13H17F2N3O and a molecular weight of 269.29 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-4-methylpiperazine-2-carboxamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-4-methylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 115178001 |
| Molecular Formula | C13H17F2N3O |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-4-methylpiperazine-2-carboxamide |
| SMILES | CN1CCNC(C(=O)NCc2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C13H17F2N3O/c1-18-5-4-16-12(8-18)13(19)17-7-9-2-3-10(14)6-11(9)15/h2-3,6,12,16H,4-5,7-8H2,1H3,(H,17,19) |
| InChIKey | GERMIQCFWVBXJO-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |