C14H20N2O3 — CID 115181303
3-amino-4-oxo-4-[(2,4,6-trimethylphenyl)methylamino]butanoic acid (PubChem CID 115181303) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 3-amino-4-oxo-4-[(2,4,6-trimethylphenyl)methylamino]butanoic acid.
| Compound Name | 3-amino-4-oxo-4-[(2,4,6-trimethylphenyl)methylamino]butanoic acid |
|---|---|
| PubChem CID | 115181303 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 3-amino-4-oxo-4-[(2,4,6-trimethylphenyl)methylamino]butanoic acid |
| SMILES | Cc1cc(C)c(CNC(=O)C(N)CC(=O)O)c(C)c1 |
| InChI | InChI=1S/C14H20N2O3/c1-8-4-9(2)11(10(3)5-8)7-16-14(19)12(15)6-13(17)18/h4-5,12H,6-7,15H2,1-3H3,(H,16,19)(H,17,18) |
| InChIKey | XDAOSEKUBFZZQJ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |