C15H17NO3 — CID 115182419
N-[2-(1-benzofuran-3-yl)ethyl]-1-(hydroxymethyl)cyclopropane-1-carboxamide (PubChem CID 115182419) has the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. Its IUPAC name is N-[2-(1-benzofuran-3-yl)ethyl]-1-(hydroxymethyl)cyclopropane-1-carboxamide.
| Compound Name | N-[2-(1-benzofuran-3-yl)ethyl]-1-(hydroxymethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 115182419 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | N-[2-(1-benzofuran-3-yl)ethyl]-1-(hydroxymethyl)cyclopropane-1-carboxamide |
| SMILES | O=C(NCCc1coc2ccccc12)C1(CO)CC1 |
| InChI | InChI=1S/C15H17NO3/c17-10-15(6-7-15)14(18)16-8-5-11-9-19-13-4-2-1-3-12(11)13/h1-4,9,17H,5-8,10H2,(H,16,18) |
| InChIKey | MEEJMYJACSDZBP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |