C16H16N2O2 — CID 115183377
N-[2-(1-benzofuran-3-yl)ethyl]-1-cyanocyclobutane-1-carboxamide (PubChem CID 115183377) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is N-[2-(1-benzofuran-3-yl)ethyl]-1-cyanocyclobutane-1-carboxamide.
| Compound Name | N-[2-(1-benzofuran-3-yl)ethyl]-1-cyanocyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 115183377 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | N-[2-(1-benzofuran-3-yl)ethyl]-1-cyanocyclobutane-1-carboxamide |
| SMILES | N#CC1(C(=O)NCCc2coc3ccccc23)CCC1 |
| InChI | InChI=1S/C16H16N2O2/c17-11-16(7-3-8-16)15(19)18-9-6-12-10-20-14-5-2-1-4-13(12)14/h1-2,4-5,10H,3,6-9H2,(H,18,19) |
| InChIKey | ADHVZSOGGZFWCZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |