C14H17NO4 — CID 115184980
3-[(2,4-dimethylphenyl)methylcarbamoyl]oxetane-3-carboxylic acid (PubChem CID 115184980) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is 3-[(2,4-dimethylphenyl)methylcarbamoyl]oxetane-3-carboxylic acid.
| Compound Name | 3-[(2,4-dimethylphenyl)methylcarbamoyl]oxetane-3-carboxylic acid |
|---|---|
| PubChem CID | 115184980 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 3-[(2,4-dimethylphenyl)methylcarbamoyl]oxetane-3-carboxylic acid |
| SMILES | Cc1ccc(CNC(=O)C2(C(=O)O)COC2)c(C)c1 |
| InChI | InChI=1S/C14H17NO4/c1-9-3-4-11(10(2)5-9)6-15-12(16)14(13(17)18)7-19-8-14/h3-5H,6-8H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | YMEMAPXLSJUZMM-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|