C15H22FNO2 — CID 115186785
N-[2-(4-fluorophenyl)-2-methylpropyl]-2-(hydroxymethyl)butanamide (PubChem CID 115186785) has the molecular formula C15H22FNO2 and a molecular weight of 267.34 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)-2-methylpropyl]-2-(hydroxymethyl)butanamide.
| Compound Name | N-[2-(4-fluorophenyl)-2-methylpropyl]-2-(hydroxymethyl)butanamide |
|---|---|
| PubChem CID | 115186785 |
| Molecular Formula | C15H22FNO2 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | N-[2-(4-fluorophenyl)-2-methylpropyl]-2-(hydroxymethyl)butanamide |
| SMILES | CCC(CO)C(=O)NCC(C)(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H22FNO2/c1-4-11(9-18)14(19)17-10-15(2,3)12-5-7-13(16)8-6-12/h5-8,11,18H,4,9-10H2,1-3H3,(H,17,19) |
| InChIKey | DKYZIRBICFXUMV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |