C28H22ClN5O2 — CID 11518884
1-(5-chloro-2-phenoxyphenyl)-3-[3-[(2-pyridin-4-ylimidazol-1-yl)methyl]phenyl]urea (PubChem CID 11518884) has the molecular formula C28H22ClN5O2 and a molecular weight of 495.97 g/mol. Its IUPAC name is 1-(5-chloro-2-phenoxyphenyl)-3-[3-[(2-pyridin-4-ylimidazol-1-yl)methyl]phenyl]urea.
| Compound Name | 1-(5-chloro-2-phenoxyphenyl)-3-[3-[(2-pyridin-4-ylimidazol-1-yl)methyl]phenyl]urea |
|---|---|
| PubChem CID | 11518884 |
| Molecular Formula | C28H22ClN5O2 |
| Molecular Weight | 495.97 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | 1-(5-chloro-2-phenoxyphenyl)-3-[3-[(2-pyridin-4-ylimidazol-1-yl)methyl]phenyl]urea |
| SMILES | O=C(Nc1cccc(Cn2ccnc2-c2ccncc2)c1)Nc1cc(Cl)ccc1Oc1ccccc1 |
| InChI | InChI=1S/C28H22ClN5O2/c29-22-9-10-26(36-24-7-2-1-3-8-24)25(18-22)33-28(35)32-23-6-4-5-20(17-23)19-34-16-15-31-27(34)21-11-13-30-14-12-21/h1-18H,19H2,(H2,32,33,35) |
| InChIKey | JPRLCOBTENRVNU-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.97 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |