C22H19ClN4O2 — CID 58703424
1-(5-chloro-2-methoxyphenyl)-3-[1-(pyridin-3-ylmethyl)indol-5-yl]urea (PubChem CID 58703424) has the molecular formula C22H19ClN4O2 and a molecular weight of 406.87 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-[1-(pyridin-3-ylmethyl)indol-5-yl]urea.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-[1-(pyridin-3-ylmethyl)indol-5-yl]urea |
|---|---|
| PubChem CID | 58703424 |
| Molecular Formula | C22H19ClN4O2 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-[1-(pyridin-3-ylmethyl)indol-5-yl]urea |
| SMILES | COc1ccc(Cl)cc1NC(=O)Nc1ccc2c(ccn2Cc2cccnc2)c1 |
| InChI | InChI=1S/C22H19ClN4O2/c1-29-21-7-4-17(23)12-19(21)26-22(28)25-18-5-6-20-16(11-18)8-10-27(20)14-15-3-2-9-24-13-15/h2-13H,14H2,1H3,(H2,25,26,28) |
| InChIKey | YYWHXRPXIFRCLS-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |