C23H20ClN5O3 — CID 121049745
1-(5-chloro-2-methoxyphenyl)-3-[[4-oxo-3-(pyridin-3-ylmethyl)phthalazin-1-yl]methyl]urea (PubChem CID 121049745) has the molecular formula C23H20ClN5O3 and a molecular weight of 449.90 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-[[4-oxo-3-(pyridin-3-ylmethyl)phthalazin-1-yl]methyl]urea.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-[[4-oxo-3-(pyridin-3-ylmethyl)phthalazin-1-yl]methyl]urea |
|---|---|
| PubChem CID | 121049745 |
| Molecular Formula | C23H20ClN5O3 |
| Molecular Weight | 449.90 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-[[4-oxo-3-(pyridin-3-ylmethyl)phthalazin-1-yl]methyl]urea |
| SMILES | COc1ccc(Cl)cc1NC(=O)NCc1nn(Cc2cccnc2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C23H20ClN5O3/c1-32-21-9-8-16(24)11-19(21)27-23(31)26-13-20-17-6-2-3-7-18(17)22(30)29(28-20)14-15-5-4-10-25-12-15/h2-12H,13-14H2,1H3,(H2,26,27,31) |
| InChIKey | NNBQPGJWNCPFAH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.90 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |