C10H13ClFN3O — CID 115192854
3-amino-1-[(2-chloro-5-fluoro-4-methylphenyl)methyl]-1-methylurea (PubChem CID 115192854) has the molecular formula C10H13ClFN3O and a molecular weight of 245.69 g/mol. Its IUPAC name is 3-amino-1-[(2-chloro-5-fluoro-4-methylphenyl)methyl]-1-methylurea.
| Compound Name | 3-amino-1-[(2-chloro-5-fluoro-4-methylphenyl)methyl]-1-methylurea |
|---|---|
| PubChem CID | 115192854 |
| Molecular Formula | C10H13ClFN3O |
| Molecular Weight | 245.69 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 3-amino-1-[(2-chloro-5-fluoro-4-methylphenyl)methyl]-1-methylurea |
| SMILES | Cc1cc(Cl)c(CN(C)C(=O)NN)cc1F |
| InChI | InChI=1S/C10H13ClFN3O/c1-6-3-8(11)7(4-9(6)12)5-15(2)10(16)14-13/h3-4H,5,13H2,1-2H3,(H,14,16) |
| InChIKey | PGURCYUUQLSQHA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.69 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|