C15H20N2 — CID 115195493
N'-[2-(6-methylnaphthalen-2-yl)ethyl]ethane-1,2-diamine (PubChem CID 115195493) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is N'-[2-(6-methylnaphthalen-2-yl)ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-(6-methylnaphthalen-2-yl)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 115195493 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | N'-[2-(6-methylnaphthalen-2-yl)ethyl]ethane-1,2-diamine |
| SMILES | Cc1ccc2cc(CCNCCN)ccc2c1 |
| InChI | InChI=1S/C15H20N2/c1-12-2-4-15-11-13(3-5-14(15)10-12)6-8-17-9-7-16/h2-5,10-11,17H,6-9,16H2,1H3 |
| InChIKey | FYBWEZZSACCQFX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|