C12H18N2O — CID 115197732
N'-(2,3-dihydro-1-benzofuran-5-yl)-N-methylpropane-1,3-diamine (PubChem CID 115197732) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is N'-(2,3-dihydro-1-benzofuran-5-yl)-N-methylpropane-1,3-diamine.
| Compound Name | N'-(2,3-dihydro-1-benzofuran-5-yl)-N-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 115197732 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | N'-(2,3-dihydro-1-benzofuran-5-yl)-N-methylpropane-1,3-diamine |
| SMILES | CNCCCNc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C12H18N2O/c1-13-6-2-7-14-11-3-4-12-10(9-11)5-8-15-12/h3-4,9,13-14H,2,5-8H2,1H3 |
| InChIKey | ZNBXNSNZPCDUNT-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|