C13H20N2O — CID 115201733
N'-(2,3-dihydro-1-benzofuran-5-yl)-N-methylbutane-1,4-diamine (PubChem CID 115201733) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is N'-(2,3-dihydro-1-benzofuran-5-yl)-N-methylbutane-1,4-diamine.
| Compound Name | N'-(2,3-dihydro-1-benzofuran-5-yl)-N-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 115201733 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | N'-(2,3-dihydro-1-benzofuran-5-yl)-N-methylbutane-1,4-diamine |
| SMILES | CNCCCCNc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C13H20N2O/c1-14-7-2-3-8-15-12-4-5-13-11(10-12)6-9-16-13/h4-5,10,14-15H,2-3,6-9H2,1H3 |
| InChIKey | YIEVUIOCXCCDMN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|