C12H20N2S — CID 115198290
N'-(4-ethylsulfanylphenyl)-2-methylpropane-1,3-diamine (PubChem CID 115198290) has the molecular formula C12H20N2S and a molecular weight of 224.37 g/mol. Its IUPAC name is N'-(4-ethylsulfanylphenyl)-2-methylpropane-1,3-diamine.
| Compound Name | N'-(4-ethylsulfanylphenyl)-2-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 115198290 |
| Molecular Formula | C12H20N2S |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | N'-(4-ethylsulfanylphenyl)-2-methylpropane-1,3-diamine |
| SMILES | CCSc1ccc(NCC(C)CN)cc1 |
| InChI | InChI=1S/C12H20N2S/c1-3-15-12-6-4-11(5-7-12)14-9-10(2)8-13/h4-7,10,14H,3,8-9,13H2,1-2H3 |
| InChIKey | NSLBRSKUVNOWIU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |