C12H20N2S — CID 116933128
1-(4-ethylsulfanylphenyl)-2-methylpropane-1,3-diamine (PubChem CID 116933128) has the molecular formula C12H20N2S and a molecular weight of 224.37 g/mol. Its IUPAC name is 1-(4-ethylsulfanylphenyl)-2-methylpropane-1,3-diamine.
| Compound Name | 1-(4-ethylsulfanylphenyl)-2-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 116933128 |
| Molecular Formula | C12H20N2S |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 1-(4-ethylsulfanylphenyl)-2-methylpropane-1,3-diamine |
| SMILES | CCSc1ccc(C(N)C(C)CN)cc1 |
| InChI | InChI=1S/C12H20N2S/c1-3-15-11-6-4-10(5-7-11)12(14)9(2)8-13/h4-7,9,12H,3,8,13-14H2,1-2H3 |
| InChIKey | WJZJROFPUDIGBF-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |