C11H18N2OS — CID 116942412
2,3-diamino-3-(4-ethylsulfanylphenyl)propan-1-ol (PubChem CID 116942412) has the molecular formula C11H18N2OS and a molecular weight of 226.34 g/mol. Its IUPAC name is 2,3-diamino-3-(4-ethylsulfanylphenyl)propan-1-ol.
| Compound Name | 2,3-diamino-3-(4-ethylsulfanylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 116942412 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 2,3-diamino-3-(4-ethylsulfanylphenyl)propan-1-ol |
| SMILES | CCSc1ccc(C(N)C(N)CO)cc1 |
| InChI | InChI=1S/C11H18N2OS/c1-2-15-9-5-3-8(4-6-9)11(13)10(12)7-14/h3-6,10-11,14H,2,7,12-13H2,1H3 |
| InChIKey | QDTDPLCVFAXVNB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |