C14H20N2O — CID 115199967
N'-(1-benzofuran-3-yl)-N',2,2-trimethylpropane-1,3-diamine (PubChem CID 115199967) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is N'-(1-benzofuran-3-yl)-N',2,2-trimethylpropane-1,3-diamine.
| Compound Name | N'-(1-benzofuran-3-yl)-N',2,2-trimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 115199967 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | N'-(1-benzofuran-3-yl)-N',2,2-trimethylpropane-1,3-diamine |
| SMILES | CN(CC(C)(C)CN)c1coc2ccccc12 |
| InChI | InChI=1S/C14H20N2O/c1-14(2,9-15)10-16(3)12-8-17-13-7-5-4-6-11(12)13/h4-8H,9-10,15H2,1-3H3 |
| InChIKey | LQCBCQPQYDCUGX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |