C13H17NO3S — CID 116853181
3-(1-benzofuran-3-ylsulfonyl)-2,2-dimethylpropan-1-amine (PubChem CID 116853181) has the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. Its IUPAC name is 3-(1-benzofuran-3-ylsulfonyl)-2,2-dimethylpropan-1-amine.
| Compound Name | 3-(1-benzofuran-3-ylsulfonyl)-2,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 116853181 |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 3-(1-benzofuran-3-ylsulfonyl)-2,2-dimethylpropan-1-amine |
| SMILES | CC(C)(CN)CS(=O)(=O)c1coc2ccccc12 |
| InChI | InChI=1S/C13H17NO3S/c1-13(2,8-14)9-18(15,16)12-7-17-11-6-4-3-5-10(11)12/h3-7H,8-9,14H2,1-2H3 |
| InChIKey | RVWROJYOKTWXQR-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |