C12H19BrN2O — CID 115201089
N'-(3-bromo-4-methoxyphenyl)-N'-methylbutane-1,4-diamine (PubChem CID 115201089) has the molecular formula C12H19BrN2O and a molecular weight of 287.20 g/mol. Its IUPAC name is N'-(3-bromo-4-methoxyphenyl)-N'-methylbutane-1,4-diamine.
| Compound Name | N'-(3-bromo-4-methoxyphenyl)-N'-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 115201089 |
| Molecular Formula | C12H19BrN2O |
| Molecular Weight | 287.20 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | N'-(3-bromo-4-methoxyphenyl)-N'-methylbutane-1,4-diamine |
| SMILES | COc1ccc(N(C)CCCCN)cc1Br |
| InChI | InChI=1S/C12H19BrN2O/c1-15(8-4-3-7-14)10-5-6-12(16-2)11(13)9-10/h5-6,9H,3-4,7-8,14H2,1-2H3 |
| InChIKey | JZRQXJSZVPMYFV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.20 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|